Compound Q&A

How is Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) typically synthesized?

Answer

Methyl 2,4-dihydroxy-6-pentylbenzoate
Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) is typically synthesized by the esterification of 2,4-dihydroxy-6-pentylbenzoic acid with methanol in the presence of a strong acid catalyst like sulfuric acid. The reaction is carried out at room temperature and yields a product with a purity of over 95%.

About

CAS No 58016-28-7
English Name Methyl 2,4-dihydroxy-6-pentylbenzoate
Molecular Formula C13H18O4
Molecular Weight 238.28299999999996 g/mol
SMILES CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC
InChIKey RQGAOBDPFOADCM-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) is a crystalline compound with a molecular w...

Compound Q&A

What industries use Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7) is used in the pharmaceutical industry as an...

Compound Q&A

What precautions should be taken when handling Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7)?

When handling Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS: 58016-28-7), it is important to use approp...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...