Compound Q&A

What precautions should be taken when handling Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

Answer

Benzophenonetetracarboxylic acid
When handling Benzophenonetetracarboxylic acid (CAS: 2479-49-4), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 2479-49-4
English Name Benzophenonetetracarboxylic acid
Molecular Formula C17H10O9
Molecular Weight 358.3 g/mol
SMILES C1=CC(=C(C=C1C(=O)C2=CC(=C(C=C2)C(=O)O)C(=O)O)C(=O)O)C(=O)O
InChIKey UITKHKNFVCYWNG-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

Benzophenonetetracarboxylic acid (CAS: 2479-49-4) is a white crystalline solid with a molecular weig...

Compound Q&A

How is Benzophenonetetracarboxylic acid (CAS: 2479-49-4) typically synthesized?

Benzophenonetetracarboxylic acid is typically synthesized through the condensation of benzophenone w...

Compound Q&A

What industries use Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

Benzophenonetetracarboxylic acid (CAS: 2479-49-4) is used in various industries, including pharmaceu...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...