Compound Q&A

What industries use Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

Answer

Benzophenonetetracarboxylic acid
Benzophenonetetracarboxylic acid (CAS: 2479-49-4) is used in various industries, including pharmaceuticals for the synthesis of drug intermediates, polymers for plastic and resin modification, and sensors for detecting specific chemical compounds. It is also utilized in the semiconductor industry for thin film deposition and in organic electronics for its conductive properties.

About

CAS No 2479-49-4
English Name Benzophenonetetracarboxylic acid
Molecular Formula C17H10O9
Molecular Weight 358.3 g/mol
SMILES C1=CC(=C(C=C1C(=O)C2=CC(=C(C=C2)C(=O)O)C(=O)O)C(=O)O)C(=O)O
InChIKey UITKHKNFVCYWNG-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

Benzophenonetetracarboxylic acid (CAS: 2479-49-4) is a white crystalline solid with a molecular weig...

Compound Q&A

How is Benzophenonetetracarboxylic acid (CAS: 2479-49-4) typically synthesized?

Benzophenonetetracarboxylic acid is typically synthesized through the condensation of benzophenone w...

Compound Q&A

What precautions should be taken when handling Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

When handling Benzophenonetetracarboxylic acid (CAS: 2479-49-4), it is essential to wear appropriate...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...