Compound Q&A

What are the physical and chemical properties of Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

Answer

Benzophenonetetracarboxylic acid
Benzophenonetetracarboxylic acid (CAS: 2479-49-4) is a white crystalline solid with a molecular weight of approximately 286.13 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive due to its carboxylic acid groups, making it prone to esterification and condensation reactions.

About

CAS No 2479-49-4
English Name Benzophenonetetracarboxylic acid
Molecular Formula C17H10O9
Molecular Weight 358.3 g/mol
SMILES C1=CC(=C(C=C1C(=O)C2=CC(=C(C=C2)C(=O)O)C(=O)O)C(=O)O)C(=O)O
InChIKey UITKHKNFVCYWNG-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Benzophenonetetracarboxylic acid (CAS: 2479-49-4) typically synthesized?

Benzophenonetetracarboxylic acid is typically synthesized through the condensation of benzophenone w...

Compound Q&A

What industries use Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

Benzophenonetetracarboxylic acid (CAS: 2479-49-4) is used in various industries, including pharmaceu...

Compound Q&A

What precautions should be taken when handling Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

When handling Benzophenonetetracarboxylic acid (CAS: 2479-49-4), it is essential to wear appropriate...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...