Compound Q&A

How is Benzophenonetetracarboxylic acid (CAS: 2479-49-4) typically synthesized?

Answer

Benzophenonetetracarboxylic acid
Benzophenonetetracarboxylic acid is typically synthesized through the condensation of benzophenone with carbon dioxide using a catalyst such as sodium hydrogen carbonate. The reaction yields a mixture of isomers, and selective separation can be achieved using column chromatography. The overall yield is moderate, around 60-70%.

About

CAS No 2479-49-4
English Name Benzophenonetetracarboxylic acid
Molecular Formula C17H10O9
Molecular Weight 358.3 g/mol
SMILES C1=CC(=C(C=C1C(=O)C2=CC(=C(C=C2)C(=O)O)C(=O)O)C(=O)O)C(=O)O
InChIKey UITKHKNFVCYWNG-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

Benzophenonetetracarboxylic acid (CAS: 2479-49-4) is a white crystalline solid with a molecular weig...

Compound Q&A

What industries use Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

Benzophenonetetracarboxylic acid (CAS: 2479-49-4) is used in various industries, including pharmaceu...

Compound Q&A

What precautions should be taken when handling Benzophenonetetracarboxylic acid (CAS: 2479-49-4)?

When handling Benzophenonetetracarboxylic acid (CAS: 2479-49-4), it is essential to wear appropriate...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...