Compound Q&A

What are the physical and chemical properties of Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate (CAS: 845256-59-9)?

Answer

Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate
Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate (CAS: 845256-59-9) is a crystalline solid with a molecular weight of approximately 265.26 g/mol. It has poor water solubility but good solubility in organic solvents such as ethanol and dichloromethane. The compound is relatively stable but may react with strong bases to form 3-fluoro-4-hydroxy-1-piperidinecarboxylic acid. It is not flammable but can release toxic fumes upon thermal decomposition.

About

English Name Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate
Molecular Formula C13H14FNO3
Molecular Weight 251.26 g/mol
SMILES FC1CN(CCC1=O)C(=O)OCc2ccccc2
InChIKey JECCYYOJLNSUHX-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate (CAS: 845256-59-9) typically synthesized?

Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate (CAS: 845256-59-9) can be synthesized via a multistep ...

Compound Q&A

What industries use Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate (CAS: 845256-59-9)?

Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate (CAS: 845256-59-9) is primarily used in pharmaceutical...

Compound Q&A

What precautions should be taken when handling Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate (CAS: 845256-59-9)?

When handling Benzyl 3-fluoro-4-oxo-1-piperidinecarboxylate (CAS: 845256-59-9), wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...