Compound Q&A

What industries use 2-(4-Butylphenyl)propanoic acid (CAS: 3585-49-7)?

Answer

2-(4-Butylphenyl)propanoic acid
2-(4-Butylphenyl)propanoic acid finds applications in pharmaceuticals, where it serves as a precursor for certain drug molecules. It is also used in the production of sensors for environmental monitoring and in the synthesis of specific polymers that require specific functional groups. Its use in semiconductors is limited but it can be a component in some organic semiconductor materials.

About

CAS No 3585-49-7
English Name 2-(4-Butylphenyl)propanoic acid
Molecular Formula C13H18O2
Molecular Weight 206.28 g/mol
SMILES CCCCC1=CC=C(C=C1)C(C)C(=O)O
InChIKey FEFPDZIYEWFQFK-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Butylphenyl)propanoic acid (CAS: 3585-49-7)?

2-(4-Butylphenyl)propanoic acid is a crystalline solid with a molecular weight of approximately 214....

Compound Q&A

How is 2-(4-Butylphenyl)propanoic acid (CAS: 3585-49-7) typically synthesized?

2-(4-Butylphenyl)propanoic acid is commonly synthesized via a Friedel-Crafts acylation process, wher...

Compound Q&A

What precautions should be taken when handling 2-(4-Butylphenyl)propanoic acid (CAS: 3585-49-7)?

When handling 2-(4-Butylphenyl)propanoic acid, it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...