Compound Q&A

How is 2-(4-Butylphenyl)propanoic acid (CAS: 3585-49-7) typically synthesized?

Answer

2-(4-Butylphenyl)propanoic acid
2-(4-Butylphenyl)propanoic acid is commonly synthesized via a Friedel-Crafts acylation process, where 4-butylation of phenylacetic acid is followed by acylation with acetyl chloride. The reaction typically requires a Lewis acid catalyst like aluminum chloride and is conducted under anhydrous conditions to achieve a yield of around 70-80%.

About

CAS No 3585-49-7
English Name 2-(4-Butylphenyl)propanoic acid
Molecular Formula C13H18O2
Molecular Weight 206.28 g/mol
SMILES CCCCC1=CC=C(C=C1)C(C)C(=O)O
InChIKey FEFPDZIYEWFQFK-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Butylphenyl)propanoic acid (CAS: 3585-49-7)?

2-(4-Butylphenyl)propanoic acid is a crystalline solid with a molecular weight of approximately 214....

Compound Q&A

What industries use 2-(4-Butylphenyl)propanoic acid (CAS: 3585-49-7)?

2-(4-Butylphenyl)propanoic acid finds applications in pharmaceuticals, where it serves as a precurso...

Compound Q&A

What precautions should be taken when handling 2-(4-Butylphenyl)propanoic acid (CAS: 3585-49-7)?

When handling 2-(4-Butylphenyl)propanoic acid, it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...