Compound Q&A

What industries use Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6)?

Answer

Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate
Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6) is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds. It also finds applications in the polymer industry as a monomer for specialized polymer formulations. Additionally, it is used in the development of sensors and semiconductors due to its unique chemical properties and functionality.

About

CAS No 77156-78-6
English Name Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate
Molecular Formula C13H13NO4
Molecular Weight 247.25 g/mol
SMILES CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)OC
InChIKey VNGGYIBIGOOVNP-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6)?

Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6) is a crystalline solid with a mol...

Compound Q&A

How is Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6) typically synthesized?

Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6) can be synthesized through a mult...

Compound Q&A

What precautions should be taken when handling Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6)?

When handling Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...