Compound Q&A

What are the physical and chemical properties of Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6)?

Answer

Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate
Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6) is a crystalline solid with a molecular weight of approximately 264.28 g/mol. It is slightly soluble in water and ethanol but more soluble in organic solvents like dichloromethane and acetonitrile. This compound exhibits good reactivity towards nucleophiles and can be used in various chemical transformations. It has a pKa of around 4.5, making it moderately acidic.

About

CAS No 77156-78-6
English Name Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate
Molecular Formula C13H13NO4
Molecular Weight 247.25 g/mol
SMILES CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)OC
InChIKey VNGGYIBIGOOVNP-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6) typically synthesized?

Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6) can be synthesized through a mult...

Compound Q&A

What industries use Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6)?

Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6) is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6)?

When handling Ethyl 4-hydroxy-6-methoxy-3-quinolinecarboxylate (CAS: 77156-78-6), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...