Compound Q&A

What industries use 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5)?

Answer

1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene
1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also employed in the polymer industry for the production of advanced materials, and in the semiconductor industry for the fabrication of electronic devices. Additionally, it has applications in the construction of sensors and optical devices.

About

CAS No 50594-31-5
English Name 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 259.99 g/mol
SMILES C1=C(C(=CC(=C1Cl)Cl)[N+](=O)[O-])C(F)(F)F
InChIKey MMUARSWOJRDXBV-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5)?

1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene is a crystalline compound with a molecular weight of...

Compound Q&A

How is 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5) typically synthesized?

1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene is commonly synthesized through a multi-step process...

Compound Q&A

What precautions should be taken when handling 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5)?

When handling 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...