Compound Q&A

How is 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5) typically synthesized?

Answer

1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene
1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene is commonly synthesized through a multi-step process involving chlorination of 4-nitro-5-(trifluoromethyl)benzene followed by nitration using nitric acid and sulfuric acid as reagents. The reaction is conducted under acidic conditions, and the product is purified by recrystallization or distillation.

About

CAS No 50594-31-5
English Name 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 259.99 g/mol
SMILES C1=C(C(=CC(=C1Cl)Cl)[N+](=O)[O-])C(F)(F)F
InChIKey MMUARSWOJRDXBV-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5)?

1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene is a crystalline compound with a molecular weight of...

Compound Q&A

What industries use 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5)?

1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5)?

When handling 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...