Compound Q&A

What are the physical and chemical properties of 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5)?

Answer

1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene
1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene is a crystalline compound with a molecular weight of approximately 316.01 g/mol. It has a low solubility in water but is more soluble in organic solvents like dichloromethane and acetone. The compound is highly reactive towards nucleophiles and electrophiles, making it useful in organic synthesis. It decomposes at high temperatures and is sensitive to strong bases and reducing agents.

About

CAS No 50594-31-5
English Name 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 259.99 g/mol
SMILES C1=C(C(=CC(=C1Cl)Cl)[N+](=O)[O-])C(F)(F)F
InChIKey MMUARSWOJRDXBV-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5) typically synthesized?

1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene is commonly synthesized through a multi-step process...

Compound Q&A

What industries use 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5)?

1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS: 50594-31-5)?

When handling 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...