Compound Q&A

What precautions should be taken when handling 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0)?

Answer

10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl)-
When handling 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up using appropriate absorbents and disposed of according to local regulations. A Material Safety Data Sheet (MSDS) should be consulted for detailed safety information and emergency procedures.

About

English Name 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl)-
Molecular Formula C16H18N4S
Molecular Weight 298.4 g/mol
SMILES CC1=CC2=C(S1)NC3=CC=CC=C3N=C2N4CCNCC4
InChIKey FHPIXVHJEIZKJW-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0)?

10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0) has a crystallin...

Compound Q&A

How is 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0) typically synthesized?

10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0) is typically syn...

Compound Q&A

What industries use 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0)?

10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0) is primarily use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...