Compound Q&A

What are the physical and chemical properties of 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0)?

Answer

10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl)-
10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0) has a crystalline form with a molecular weight of approximately 363.46 g/mol. It is slightly soluble in water but soluble in organic solvents such as ethanol and dioxane. The compound is relatively stable under normal conditions but may react with strong acids or bases. It has a melting point of around 150-152°C.

About

English Name 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl)-
Molecular Formula C16H18N4S
Molecular Weight 298.4 g/mol
SMILES CC1=CC2=C(S1)NC3=CC=CC=C3N=C2N4CCNCC4
InChIKey FHPIXVHJEIZKJW-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0) typically synthesized?

10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0) is typically syn...

Compound Q&A

What industries use 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0)?

10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0) is primarily use...

Compound Q&A

What precautions should be taken when handling 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0)?

When handling 10H-Thieno[2,3-b][1,5]benzodiazepine, 2-methyl-4-(1-piperazinyl) (CAS: 161696-76-0), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...