Compound Q&A

What are the physical and chemical properties of 3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one (CAS: 4504-94-3)?

Answer

3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one
3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one is a white crystalline solid with a molecular weight of approximately 341.15 g/mol. It has limited water solubility but is more soluble in organic solvents like DMSO and DMF. The compound is known for its stability under normal conditions but requires careful handling due to its reactivity with certain reagents.

About

CAS No 4504-94-3
English Name 3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one
Molecular Formula C15H9F3O2
Molecular Weight 278.23 g/mol
SMILES O=C1c2ccc(cc2OCc2c1cccc2)C(F)(F)F
InChIKey LJXVSEITOIGFPP-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is 3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one (CAS: 4504-94-3) typically synthesized?

3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one can be synthesized via a multistep reaction involvi...

Compound Q&A

What industries use 3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one (CAS: 4504-94-3)?

3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one finds applications in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one (CAS: 4504-94-3)?

When handling 3-(Trifluoromethyl)dibenzo[b,e]oxepin-11(6H)-one, it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...