Compound Q&A

What industries use 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3)?

Answer

2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate
2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate is used in various industries, particularly in pharmaceuticals for the development of new drug candidates, and in polymer chemistry for synthesizing functional polymers. It also finds applications in the production of sensors and semiconductors due to its unique chemical properties.

About

English Name 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES CC1CCN(CCN1)C(=O)OC(C)(C)C
InChIKey SVMXIQUBNSPVCB-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3)?

2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate has a crystalline form with a molecular wei...

Compound Q&A

How is 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3) typically synthesized?

2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate is typically synthesized through a multi-st...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3)?

When handling 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate, it is crucial to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...