Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3)?

Answer

2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate
2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate has a crystalline form with a molecular weight of approximately 266.35 g/mol. It is slightly soluble in water but more soluble in organic solvents like dichloromethane and ethanol. This compound exhibits good stability under normal conditions but is reactive towards acidic or basic conditions. It is commonly used in chemical synthesis and pharmaceutical applications.

About

English Name 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES CC1CCN(CCN1)C(=O)OC(C)(C)C
InChIKey SVMXIQUBNSPVCB-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3) typically synthesized?

2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate is typically synthesized through a multi-st...

Compound Q&A

What industries use 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3)?

2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate is used in various industries, particularly...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3)?

When handling 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate, it is crucial to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...