Compound Q&A

How is 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3) typically synthesized?

Answer

2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate
2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate is typically synthesized through a multi-step process involving diazepine formation and subsequent esterification. Commonly, this involves reacting a 5-methyl-1,4-diazepine with 2-methyl-2-propanol in the presence of a mild acid catalyst like hydrochloric acid. The reaction yields a pure product with high selectivity and good yield.

About

English Name 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES CC1CCN(CCN1)C(=O)OC(C)(C)C
InChIKey SVMXIQUBNSPVCB-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3)?

2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate has a crystalline form with a molecular wei...

Compound Q&A

What industries use 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3)?

2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate is used in various industries, particularly...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-42-3)?

When handling 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate, it is crucial to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...