Compound Q&A

What precautions should be taken when handling 6-Bromo-2-methyl-4-quinolinol (CAS: 103030-28-0)?

Answer

6-Bromo-2-methyl-4-quinolinol
When handling 6-Bromo-2-methyl-4-quinolinol (CAS: 103030-28-0), wear appropriate personal protective equipment (PPE), such as gloves, goggles, and a lab coat. Use a fume hood to minimize exposure to fumes. Store the compound in a tightly sealed container in a cool, dry place away from direct sunlight. In case of a spill, handle it carefully and follow proper disposal procedures. Refer to the Safety Data Sheet (SDS) for detailed information on handling and emergency procedures.

About

English Name 6-Bromo-2-methyl-4-quinolinol
Molecular Formula C10H8BrNO
Molecular Weight 238.08 g/mol
SMILES CC1=CC(=O)C2=C(N1)C=CC(=C2)Br
InChIKey WPSHYKVAGQUPJD-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-2-methyl-4-quinolinol (CAS: 103030-28-0)?

6-Bromo-2-methyl-4-quinolinol (CAS: 103030-28-0) is a brown crystalline solid with a molecular weigh...

Compound Q&A

How is 6-Bromo-2-methyl-4-quinolinol (CAS: 103030-28-0) typically synthesized?

6-Bromo-2-methyl-4-quinolinol is typically synthesized through the bromination of 2-methyl-4-quinoli...

Compound Q&A

What industries use 6-Bromo-2-methyl-4-quinolinol (CAS: 103030-28-0)?

6-Bromo-2-methyl-4-quinolinol (CAS: 103030-28-0) is used in the pharmaceutical industry for the synt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...