Compound Q&A

What precautions should be taken when handling 3'-Deoxycytidine (CAS: 7057-33-2)?

Answer

3'-Deoxycytidine
Proper handling of 3'-Deoxycytidine (CAS: 7057-33-2) requires the use of personal protective equipment (PPE) such as gloves and safety goggles. The compound should be stored in a cool, dry place away from heat sources and incompatible materials. If a spill occurs, it should be immediately cleaned up under a fume hood. Always refer to the safety data sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 7057-33-2
English Name 3'-Deoxycytidine
Molecular Formula C9H13N3O4
Molecular Weight 227.22 g/mol
SMILES C1C(OC(C1O)N2C=CC(=NC2=O)N)CO
InChIKey ZHHOTKZTEUZTHX-SHYZEUOFSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3'-Deoxycytidine (CAS: 7057-33-2)?

3'-Deoxycytidine (CAS: 7057-33-2) is a white or off-white crystalline compound with a molecular weig...

Compound Q&A

How is 3'-Deoxycytidine (CAS: 7057-33-2) typically synthesized?

3'-Deoxycytidine is typically synthesized via nucleobase modification of cytidine. A common method i...

Compound Q&A

What industries use 3'-Deoxycytidine (CAS: 7057-33-2)?

3'-Deoxycytidine (CAS: 7057-33-2) finds applications in pharmaceuticals, particularly in the develop...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...