Compound Q&A

What precautions should be taken when handling (2E)-3-(2,3,4-Trifluorophenyl)acrylic acid (CAS: 207742-85-6)?

Answer

(2E)-3-(2,3,4-Trifluorophenyl)acrylic acid
When handling (2E)-3-(2,3,4-Trifluorophenyl)acrylic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store it in a fume hood and avoid contact with moisture and light. In case of a spill, immediately contain it and follow the safety data sheet (SDS) guidelines for disposal.

About

English Name (2E)-3-(2,3,4-Trifluorophenyl)acrylic acid
Molecular Formula C9H5F3O2
Molecular Weight 202.13 g/mol
SMILES C1=CC(=C(C(=C1C=CC(=O)O)F)F)F
InChIKey AYDLBRHSHLRVAH-DUXPYHPUSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2E)-3-(2,3,4-Trifluorophenyl)acrylic acid (CAS: 207742-85-6)?

(2E)-3-(2,3,4-Trifluorophenyl)acrylic acid has a crystalline form, a molecular weight of approximate...

Compound Q&A

How is (2E)-3-(2,3,4-Trifluorophenyl)acrylic acid (CAS: 207742-85-6) typically synthesized?

(2E)-3-(2,3,4-Trifluorophenyl)acrylic acid is typically synthesized via a Friedel–Crafts alkylation ...

Compound Q&A

What industries use (2E)-3-(2,3,4-Trifluorophenyl)acrylic acid (CAS: 207742-85-6)?

(2E)-3-(2,3,4-Trifluorophenyl)acrylic acid finds applications in pharmaceuticals for drug synthesis,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...