Compound Q&A

What industries use 2-Amino-5-cyanobenzoic acid (CAS: 99767-45-0)?

Answer

2-Amino-5-cyanobenzoic acid
2-Amino-5-cyanobenzoic acid is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry as a monomer, and in the sensor and semiconductor industries for specific applications. Its unique chemical properties make it valuable in these sectors for its functional groups and reactivity.

About

CAS No 99767-45-0
English Name 2-Amino-5-cyanobenzoic acid
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=CC(=C(C=C1C#N)C(=O)O)N
InChIKey HQNZNIJPAYTWJK-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-5-cyanobenzoic acid (CAS: 99767-45-0)?

2-Amino-5-cyanobenzoic acid is a crystalline compound with a molecular weight of approximately 179.0...

Compound Q&A

How is 2-Amino-5-cyanobenzoic acid (CAS: 99767-45-0) typically synthesized?

2-Amino-5-cyanobenzoic acid can be synthesized through a multi-step process involving the coupling o...

Compound Q&A

What precautions should be taken when handling 2-Amino-5-cyanobenzoic acid (CAS: 99767-45-0)?

When handling 2-Amino-5-cyanobenzoic acid, it is crucial to use personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...