Compound Q&A

What are the physical and chemical properties of 2-Amino-5-cyanobenzoic acid (CAS: 99767-45-0)?

Answer

2-Amino-5-cyanobenzoic acid
2-Amino-5-cyanobenzoic acid is a crystalline compound with a molecular weight of approximately 179.08 g/mol. It has a melting point of 235-236°C and is slightly soluble in water. It reacts with bases to form salts and is prone to hydrolysis under acidic conditions. The compound is stable under normal conditions but should be handled with care due to its sensitivity to moisture and light.

About

CAS No 99767-45-0
English Name 2-Amino-5-cyanobenzoic acid
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=CC(=C(C=C1C#N)C(=O)O)N
InChIKey HQNZNIJPAYTWJK-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is 2-Amino-5-cyanobenzoic acid (CAS: 99767-45-0) typically synthesized?

2-Amino-5-cyanobenzoic acid can be synthesized through a multi-step process involving the coupling o...

Compound Q&A

What industries use 2-Amino-5-cyanobenzoic acid (CAS: 99767-45-0)?

2-Amino-5-cyanobenzoic acid is used in the pharmaceutical industry for the synthesis of certain drug...

Compound Q&A

What precautions should be taken when handling 2-Amino-5-cyanobenzoic acid (CAS: 99767-45-0)?

When handling 2-Amino-5-cyanobenzoic acid, it is crucial to use personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...