Compound Q&A

What industries use 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7)?

Answer

7-Chloro-1H-indole-3-carbaldehyde
7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7) is primarily used in the pharmaceutical industry for the synthesis of various indole derivatives with potential medicinal properties. It is also used in the production of certain dyes and pigments, as well as in some sensor applications due to its reactivity and specific functional groups. Its use in semiconductors and polymers is less common but not unheard of, depending on the specific chemical environment and reactivity of the compound.

About

CAS No 1008-07-7
English Name 7-Chloro-1H-indole-3-carbaldehyde
Molecular Formula C9H6ClNO
Molecular Weight 179.61 g/mol
SMILES C1=CC2=C(C(=C1)Cl)NC=C2C=O
InChIKey NHJNOJSRXQVQRT-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7)?

7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7) typically synthesized?

7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7) can be synthesized by the reduction of 7-chloro-1...

Compound Q&A

What precautions should be taken when handling 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7)?

When handling 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7), appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...