Compound Q&A

How is 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7) typically synthesized?

Answer

7-Chloro-1H-indole-3-carbaldehyde
7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7) can be synthesized by the reduction of 7-chloro-1H-indole-3-carboxylic acid with sodium borohydride or lithium aluminum hydride. The reaction is carried out in a suitable organic solvent such as methanol or ethanol. The yield is typically around 70-80%, with good selectivity for the reduction of the carboxylic acid to the aldehyde. Proper use of a catalyst and appropriate conditions are essential for optimal results.

About

CAS No 1008-07-7
English Name 7-Chloro-1H-indole-3-carbaldehyde
Molecular Formula C9H6ClNO
Molecular Weight 179.61 g/mol
SMILES C1=CC2=C(C(=C1)Cl)NC=C2C=O
InChIKey NHJNOJSRXQVQRT-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7)?

7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7)?

7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7)?

When handling 7-Chloro-1H-indole-3-carbaldehyde (CAS: 1008-07-7), appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...