Compound Q&A

What precautions should be taken when handling 2-Phenyl-3-pyridinamine (CAS: 101601-80-3)?

Answer

2-Phenyl-3-pyridinamine
When handling 2-Phenyl-3-pyridinamine, it is crucial to ensure proper ventilation and use a fume hood. Wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Store the compound in a cool, dry place, away from oxidizers and flammable materials. In case of a spill, use appropriate absorbent materials and follow safety data sheet (SDS) guidelines for disposal.

About

English Name 2-Phenyl-3-pyridinamine
Molecular Formula C11H10N2
Molecular Weight 170.22 g/mol
SMILES C1=CC=C(C=C1)C2=C(C=CC=N2)N
InChIKey XTHJCITVHCRQRD-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Phenyl-3-pyridinamine (CAS: 101601-80-3)?

2-Phenyl-3-pyridinamine is a crystalline compound with a molecular weight of approximately 168.18 g/...

Compound Q&A

How is 2-Phenyl-3-pyridinamine (CAS: 101601-80-3) typically synthesized?

2-Phenyl-3-pyridinamine is commonly synthesized via the condensation of 3-aminopyridine with phenyl ...

Compound Q&A

What industries use 2-Phenyl-3-pyridinamine (CAS: 101601-80-3)?

2-Phenyl-3-pyridinamine finds applications in the pharmaceutical industry as a starting material for...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...