Compound Q&A

How is 3-Chloro-5-nitro-1H-indazole (CAS: 4812-45-7) typically synthesized?

Answer

3-Chloro-5-nitro-1H-indazole
3-Chloro-5-nitro-1H-indazole can be synthesized via the nitration of 3-chloro-1H-indazole followed by the removal of the hydroxyl group. Commonly, this involves refluxing 3-chloro-1H-indazole with nitric acid in the presence of sulfuric acid. The yield of the reaction is typically around 75-85%, with careful control of reaction conditions to achieve high selectivity and purity.

About

CAS No 4812-45-7
English Name 3-Chloro-5-nitro-1H-indazole
Molecular Formula C7H4ClN3O2
Molecular Weight 197.58 g/mol
SMILES C1=CC2=NNC(=C2C=C1[N+](=O)[O-])Cl
InChIKey UOWPRWCAMGTPHI-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-5-nitro-1H-indazole (CAS: 4812-45-7)?

3-Chloro-5-nitro-1H-indazole is a crystalline solid with a molecular weight of approximately 228.57 ...

Compound Q&A

What industries use 3-Chloro-5-nitro-1H-indazole (CAS: 4812-45-7)?

3-Chloro-5-nitro-1H-indazole is primarily used in the pharmaceutical industry as an intermediate for...

Compound Q&A

What precautions should be taken when handling 3-Chloro-5-nitro-1H-indazole (CAS: 4812-45-7)?

When handling 3-Chloro-5-nitro-1H-indazole, it is essential to use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...