Compound Q&A

What are the physical and chemical properties of 3-Chloro-5-nitro-1H-indazole (CAS: 4812-45-7)?

Answer

3-Chloro-5-nitro-1H-indazole
3-Chloro-5-nitro-1H-indazole is a crystalline solid with a molecular weight of approximately 228.57 g/mol. It is only slightly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound is known for its high reactivity towards nucleophiles and can undergo substitution reactions easily. It is a yellowish to orange crystalline solid at room temperature.

About

CAS No 4812-45-7
English Name 3-Chloro-5-nitro-1H-indazole
Molecular Formula C7H4ClN3O2
Molecular Weight 197.58 g/mol
SMILES C1=CC2=NNC(=C2C=C1[N+](=O)[O-])Cl
InChIKey UOWPRWCAMGTPHI-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is 3-Chloro-5-nitro-1H-indazole (CAS: 4812-45-7) typically synthesized?

3-Chloro-5-nitro-1H-indazole can be synthesized via the nitration of 3-chloro-1H-indazole followed b...

Compound Q&A

What industries use 3-Chloro-5-nitro-1H-indazole (CAS: 4812-45-7)?

3-Chloro-5-nitro-1H-indazole is primarily used in the pharmaceutical industry as an intermediate for...

Compound Q&A

What precautions should be taken when handling 3-Chloro-5-nitro-1H-indazole (CAS: 4812-45-7)?

When handling 3-Chloro-5-nitro-1H-indazole, it is essential to use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...