Compound Q&A

What precautions should be taken when handling (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7)?

Answer

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane)
Proper personal protective equipment (PPE) should be worn, including gloves, goggles, and a lab coat. The compound should be handled in a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbents, and the area should be well-ventilated. Safety data sheets (SDS) should be consulted for detailed handling instructions and emergency procedures.

About

English Name (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane)
Molecular Formula C34H36P2
Molecular Weight 506.61 g/mol
SMILES c1ccc(cc1)[C@@H]2CC[C@H](P2CCP3[C@@H](CC[C@H]3c4ccccc4)c5ccccc5)c6ccccc6
InChIKey VHHAZLMVLLIMHT-CUPIEXAXSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7)?

The compound has a crystalline form with a molecular weight of approximately 554.6 g/mol. It is poor...

Compound Q&A

How is (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7) typically synthesized?

The compound is typically synthesized via a Wittig-Horner reaction involving phenylphosphines and et...

Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7)?

This compound is used in various industries, including pharmaceuticals for its chelating properties,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...