Compound Q&A

How is (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7) typically synthesized?

Answer

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane)
The compound is typically synthesized via a Wittig-Horner reaction involving phenylphosphines and ethylene glycol. The reaction involves the condensation of phenylphosphines with ethylene glycol under basic conditions, followed by purification steps. Commonly used catalysts include triphenylphosphine and triethylamine, yielding a high purity product with good selectivity and yield.

About

English Name (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane)
Molecular Formula C34H36P2
Molecular Weight 506.61 g/mol
SMILES c1ccc(cc1)[C@@H]2CC[C@H](P2CCP3[C@@H](CC[C@H]3c4ccccc4)c5ccccc5)c6ccccc6
InChIKey VHHAZLMVLLIMHT-CUPIEXAXSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7)?

The compound has a crystalline form with a molecular weight of approximately 554.6 g/mol. It is poor...

Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7)?

This compound is used in various industries, including pharmaceuticals for its chelating properties,...

Compound Q&A

What precautions should be taken when handling (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7)?

Proper personal protective equipment (PPE) should be worn, including gloves, goggles, and a lab coat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...