Compound Q&A

What are the physical and chemical properties of (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7)?

Answer

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane)
The compound has a crystalline form with a molecular weight of approximately 554.6 g/mol. It is poorly soluble in water but soluble in organic solvents like dichloromethane and acetonitrile. Chemically, it is stable under normal conditions but reacts with strong oxidizing agents. Its reactivity is dependent on the presence of phenyl groups, which can participate in various synthetic transformations.

About

English Name (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane)
Molecular Formula C34H36P2
Molecular Weight 506.61 g/mol
SMILES c1ccc(cc1)[C@@H]2CC[C@H](P2CCP3[C@@H](CC[C@H]3c4ccccc4)c5ccccc5)c6ccccc6
InChIKey VHHAZLMVLLIMHT-CUPIEXAXSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7) typically synthesized?

The compound is typically synthesized via a Wittig-Horner reaction involving phenylphosphines and et...

Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7)?

This compound is used in various industries, including pharmaceuticals for its chelating properties,...

Compound Q&A

What precautions should be taken when handling (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-diphenylphospholane) (CAS: 824395-67-7)?

Proper personal protective equipment (PPE) should be worn, including gloves, goggles, and a lab coat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...