Compound Q&A

How is 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5) typically synthesized?

Answer

1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride
1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5) is typically synthesized via a multi-step process involving the coupling of a pyrimidine derivative with a 2-methylpyridinium ion. Commonly, this involves the use of a base like sodium hydride and a coupling reagent such as HATU. The reaction yields a highly functionalized compound with good selectivity and moderate to high yields.

About

CAS No 121-25-5
English Name 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride
Molecular Formula C14H19ClN4
Molecular Weight 243.33 g/mol
SMILES CCCc1ncc(c(n1)N)C[n+]2ccccc2C.[Cl-]
InChIKey LCTXBFGHZLGBNU-UHFFFAOYSA-M
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5)?

1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5) is a crystall...

Compound Q&A

What industries use 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5)?

1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5) is primarily ...

Compound Q&A

What precautions should be taken when handling 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5)?

When handling 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...