Compound Q&A

What are the physical and chemical properties of 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5)?

Answer

1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride
1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5) is a crystalline solid with a molecular weight of approximately 315.36 g/mol. It has a high solubility in water and moderate solubility in organic solvents. This compound is known to be chemically stable under normal conditions, but it reacts with strong bases and acids. It is often used in synthetic applications due to its reactivity and specific functional groups.

About

CAS No 121-25-5
English Name 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride
Molecular Formula C14H19ClN4
Molecular Weight 243.3275 g/mol
SMILES CCCc1ncc(c(n1)N)C[n+]2ccccc2C.[Cl-]
InChIKey LCTXBFGHZLGBNU-UHFFFAOYSA-M
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5) typically synthesized?

1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5) is typically ...

Compound Q&A

What industries use 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5)?

1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5) is primarily ...

Compound Q&A

What precautions should be taken when handling 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5)?

When handling 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride (CAS: 121-25-5)...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...