Compound Q&A

What industries use Benzyl pyrrolidine-2-carboxylate hydrochloride (CAS: 8008-94-4)?

Answer

Benzyl pyrrolidine-2-carboxylate hydrochloride
Benzyl pyrrolidine-2-carboxylate hydrochloride is primarily used in the pharmaceutical industry for the synthesis of various drug intermediates. It is also utilized in the polymer industry for the production of certain types of polymers. Additionally, it can be used in the sensor and semiconductor industries for specific applications requiring its chemical properties.

About

CAS No 8008-94-4
English Name Benzyl pyrrolidine-2-carboxylate hydrochloride
Molecular Formula C12H16ClNO2
Molecular Weight 241.71 g/mol
EINECS 283-895-2
SMILES Cl.O(CC1C=CC=CC=1)C(C1CCCN1)=O
InChIKey NEDMOHHWRPHBAL-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl pyrrolidine-2-carboxylate hydrochloride (CAS: 8008-94-4)?

Benzyl pyrrolidine-2-carboxylate hydrochloride is a white to off-white crystalline solid with a mole...

Compound Q&A

How is Benzyl pyrrolidine-2-carboxylate hydrochloride (CAS: 8008-94-4) typically synthesized?

Benzyl pyrrolidine-2-carboxylate hydrochloride is typically synthesized by the condensation of benzy...

Compound Q&A

What precautions should be taken when handling Benzyl pyrrolidine-2-carboxylate hydrochloride (CAS: 8008-94-4)?

When handling Benzyl pyrrolidine-2-carboxylate hydrochloride, personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...