Compound Q&A

How is Benzyl pyrrolidine-2-carboxylate hydrochloride (CAS: 8008-94-4) typically synthesized?

Answer

Benzyl pyrrolidine-2-carboxylate hydrochloride
Benzyl pyrrolidine-2-carboxylate hydrochloride is typically synthesized by the condensation of benzylamine and pyrrolidine-2-carboxylic acid, followed by the addition of hydrochloric acid to form the hydrochloride salt. This process involves the use of a catalyst such as 4-dimethylaminopyridine (DMAP) for better selectivity and yield, which is around 85-90%.

About

CAS No 8008-94-4
English Name Benzyl pyrrolidine-2-carboxylate hydrochloride
Molecular Formula C12H16ClNO2
Molecular Weight 241.71 g/mol
EINECS 283-895-2
SMILES Cl.O(CC1C=CC=CC=1)C(C1CCCN1)=O
InChIKey NEDMOHHWRPHBAL-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl pyrrolidine-2-carboxylate hydrochloride (CAS: 8008-94-4)?

Benzyl pyrrolidine-2-carboxylate hydrochloride is a white to off-white crystalline solid with a mole...

Compound Q&A

What industries use Benzyl pyrrolidine-2-carboxylate hydrochloride (CAS: 8008-94-4)?

Benzyl pyrrolidine-2-carboxylate hydrochloride is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling Benzyl pyrrolidine-2-carboxylate hydrochloride (CAS: 8008-94-4)?

When handling Benzyl pyrrolidine-2-carboxylate hydrochloride, personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...