Compound Q&A

What industries use 3-Methoxybenzenesulfonyl chloride (CAS: 10130-74-2)?

Answer

3-Methoxybenzenesulfonyl chloride
3-Methoxybenzenesulfonyl chloride is primarily used in the pharmaceutical and polymer industries for the synthesis of intermediates. It is also used in the production of sensors and semiconductors due to its reactivity and chemical stability.

About

CAS No 10130-74-2
English Name 3-Methoxybenzenesulfonyl chloride
Molecular Formula C7H7ClO3S
Molecular Weight 206.65 g/mol
SMILES COC1=CC(=CC=C1)S(=O)(=O)Cl
InChIKey JHJKSEKUZNJKGO-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methoxybenzenesulfonyl chloride (CAS: 10130-74-2)?

3-Methoxybenzenesulfonyl chloride is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 3-Methoxybenzenesulfonyl chloride (CAS: 10130-74-2) typically synthesized?

3-Methoxybenzenesulfonyl chloride is typically synthesized by sulfonylation of 3-methoxybenzene usin...

Compound Q&A

What precautions should be taken when handling 3-Methoxybenzenesulfonyl chloride (CAS: 10130-74-2)?

When handling 3-Methoxybenzenesulfonyl chloride, it is crucial to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...