Compound Q&A

How is 3-Methoxybenzenesulfonyl chloride (CAS: 10130-74-2) typically synthesized?

Answer

3-Methoxybenzenesulfonyl chloride
3-Methoxybenzenesulfonyl chloride is typically synthesized by sulfonylation of 3-methoxybenzene using thionyl chloride. The reaction is performed under anhydrous conditions and is exothermic, yielding a selective and efficient product with good yield.

About

CAS No 10130-74-2
English Name 3-Methoxybenzenesulfonyl chloride
Molecular Formula C7H7ClO3S
Molecular Weight 206.65 g/mol
SMILES COC1=CC(=CC=C1)S(=O)(=O)Cl
InChIKey JHJKSEKUZNJKGO-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methoxybenzenesulfonyl chloride (CAS: 10130-74-2)?

3-Methoxybenzenesulfonyl chloride is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 3-Methoxybenzenesulfonyl chloride (CAS: 10130-74-2)?

3-Methoxybenzenesulfonyl chloride is primarily used in the pharmaceutical and polymer industries for...

Compound Q&A

What precautions should be taken when handling 3-Methoxybenzenesulfonyl chloride (CAS: 10130-74-2)?

When handling 3-Methoxybenzenesulfonyl chloride, it is crucial to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...