Compound Q&A

What industries use 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0)?

Answer

1-Methoxy-2,3-dimethyl-4-nitrobenzene
1-Methoxy-2,3-dimethyl-4-nitrobenzene is used in various industries. It is a key intermediate in the pharmaceutical industry for the synthesis of certain medications. In the polymer industry, it serves as a component in the production of specific types of plastics. Additionally, it is utilized in the sensing technology for detecting specific chemical species and in semiconductor manufacturing for certain dopant applications.

About

CAS No 81029-03-0
English Name 1-Methoxy-2,3-dimethyl-4-nitrobenzene
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES CC1=C(C=CC(=C1C)OC)[N+](=O)[O-]
InChIKey DUBFMQLUMHKYOX-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0)?

1-Methoxy-2,3-dimethyl-4-nitrobenzene is a yellow crystalline solid. Its molecular weight is approxi...

Compound Q&A

How is 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0) typically synthesized?

1-Methoxy-2,3-dimethyl-4-nitrobenzene can be synthesized through a series of reactions starting with...

Compound Q&A

What precautions should be taken when handling 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0)?

When handling 1-Methoxy-2,3-dimethyl-4-nitrobenzene, ensure to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...