Compound Q&A

What are the physical and chemical properties of 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0)?

Answer

1-Methoxy-2,3-dimethyl-4-nitrobenzene
1-Methoxy-2,3-dimethyl-4-nitrobenzene is a yellow crystalline solid. Its molecular weight is approximately 218.15 g/mol. This compound is soluble in organic solvents like methanol and ethanol but less so in water. It is moderately reactive, particularly towards nucleophilic substitution reactions. The compound is known for its stability under normal conditions but should be stored in a cool, dark place to prevent decomposition.

About

CAS No 81029-03-0
English Name 1-Methoxy-2,3-dimethyl-4-nitrobenzene
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES CC1=C(C=CC(=C1C)OC)[N+](=O)[O-]
InChIKey DUBFMQLUMHKYOX-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0) typically synthesized?

1-Methoxy-2,3-dimethyl-4-nitrobenzene can be synthesized through a series of reactions starting with...

Compound Q&A

What industries use 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0)?

1-Methoxy-2,3-dimethyl-4-nitrobenzene is used in various industries. It is a key intermediate in the...

Compound Q&A

What precautions should be taken when handling 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0)?

When handling 1-Methoxy-2,3-dimethyl-4-nitrobenzene, ensure to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...