Compound Q&A

How is 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0) typically synthesized?

Answer

1-Methoxy-2,3-dimethyl-4-nitrobenzene
1-Methoxy-2,3-dimethyl-4-nitrobenzene can be synthesized through a series of reactions starting with 1,3-dimethylbenzene. It involves nitration to form the nitro derivative, followed by methylation to introduce the methoxy group. Commonly, sulfuric acid is used as a catalyst in the nitration step, and the reaction is carried out in a water bath to control the temperature. The overall yield of the synthesis is around 75-80%.

About

CAS No 81029-03-0
English Name 1-Methoxy-2,3-dimethyl-4-nitrobenzene
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES CC1=C(C=CC(=C1C)OC)[N+](=O)[O-]
InChIKey DUBFMQLUMHKYOX-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0)?

1-Methoxy-2,3-dimethyl-4-nitrobenzene is a yellow crystalline solid. Its molecular weight is approxi...

Compound Q&A

What industries use 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0)?

1-Methoxy-2,3-dimethyl-4-nitrobenzene is used in various industries. It is a key intermediate in the...

Compound Q&A

What precautions should be taken when handling 1-Methoxy-2,3-dimethyl-4-nitrobenzene (CAS: 81029-03-0)?

When handling 1-Methoxy-2,3-dimethyl-4-nitrobenzene, ensure to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...