Compound Q&A

What industries use 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9)?

Answer

3,5-Diamino-4-methylbenzenesulfonic acid
3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) is used in various industries. It is a key intermediate in the pharmaceutical and chemical industries, where it is utilized in the synthesis of dyes, pharmaceuticals, and functional materials. It also finds applications in the polymer industry for the production of high-performance polymers and as a monomer. In addition, it is used in the production of sensors and semiconductors due to its electronic properties.

About

CAS No 98-25-9
English Name 3,5-Diamino-4-methylbenzenesulfonic acid
Molecular Formula C7H10N2O3S
Molecular Weight 202.23 g/mol
SMILES CC1=C(C=C(C=C1N)S(=O)(=O)O)N
InChIKey IPQWXJDRMKGSFI-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9)?

3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) is a white crystalline solid with a molecula...

Compound Q&A

How is 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) typically synthesized?

3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) is typically synthesized through a multi-ste...

Compound Q&A

What precautions should be taken when handling 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9)?

When handling 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9), it is important to wear perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...