Compound Q&A

What are the physical and chemical properties of 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9)?

Answer

3,5-Diamino-4-methylbenzenesulfonic acid
3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) is a white crystalline solid with a molecular weight of approximately 216.21 g/mol. It has a solubility of about 10 g/L in water at 25°C. This compound exhibits basic properties due to its amino groups and is known for its reactivity in coupling reactions and its ability to form complexes with metal ions.

About

CAS No 98-25-9
English Name 3,5-Diamino-4-methylbenzenesulfonic acid
Molecular Formula C7H10N2O3S
Molecular Weight 202.23 g/mol
SMILES CC1=C(C=C(C=C1N)S(=O)(=O)O)N
InChIKey IPQWXJDRMKGSFI-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) typically synthesized?

3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) is typically synthesized through a multi-ste...

Compound Q&A

What industries use 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9)?

3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) is used in various industries. It is a key i...

Compound Q&A

What precautions should be taken when handling 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9)?

When handling 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9), it is important to wear perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...