Compound Q&A

How is 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) typically synthesized?

Answer

3,5-Diamino-4-methylbenzenesulfonic acid
3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) is typically synthesized through a multi-step process involving the sulfonation of 4-methylbenzene, followed by the coupling of the sulfonic acid with diamines. Commonly used catalysts include sulfuric acid, and the reaction is optimized for high selectivity and yield, often achieved through careful control of temperature and reagent concentration.

About

CAS No 98-25-9
English Name 3,5-Diamino-4-methylbenzenesulfonic acid
Molecular Formula C7H10N2O3S
Molecular Weight 202.23 g/mol
SMILES CC1=C(C=C(C=C1N)S(=O)(=O)O)N
InChIKey IPQWXJDRMKGSFI-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9)?

3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) is a white crystalline solid with a molecula...

Compound Q&A

What industries use 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9)?

3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9) is used in various industries. It is a key i...

Compound Q&A

What precautions should be taken when handling 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9)?

When handling 3,5-Diamino-4-methylbenzenesulfonic acid (CAS: 98-25-9), it is important to wear perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...