Compound Q&A

What industries use 3,4-Furandicarboxylic acid (CAS: 3387-26-6)?

Answer

3,4-Furandicarboxylic acid
3,4-Furandicarboxylic acid (CAS: 3387-26-6) finds applications in various industries. It is used in the pharmaceutical sector for the synthesis of biologically active compounds. In the polymer industry, it serves as a monomer for the production of high-performance polymers. Additionally, it is utilized in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 3387-26-6
English Name 3,4-Furandicarboxylic acid
Molecular Formula C6H4O5
Molecular Weight 156.09 g/mol
SMILES C1=C(C(=CO1)C(=O)O)C(=O)O
InChIKey SYLAFCZSYRXBJF-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Furandicarboxylic acid (CAS: 3387-26-6)?

3,4-Furandicarboxylic acid (CAS: 3387-26-6) is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 3,4-Furandicarboxylic acid (CAS: 3387-26-6) typically synthesized?

3,4-Furandicarboxylic acid is typically synthesized by the ring oxidation of 2,5-furandione. This pr...

Compound Q&A

What precautions should be taken when handling 3,4-Furandicarboxylic acid (CAS: 3387-26-6)?

When handling 3,4-Furandicarboxylic acid (CAS: 3387-26-6), it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...