Compound Q&A

How is 3,4-Furandicarboxylic acid (CAS: 3387-26-6) typically synthesized?

Answer

3,4-Furandicarboxylic acid
3,4-Furandicarboxylic acid is typically synthesized by the ring oxidation of 2,5-furandione. This process often involves the use of peroxyacids as oxidants. The reaction is conducted in an aqueous phase with careful control of temperature and pH to achieve high yield and selectivity. Catalysts such as sulfuric acid are sometimes used to enhance the reaction efficiency.

About

CAS No 3387-26-6
English Name 3,4-Furandicarboxylic acid
Molecular Formula C6H4O5
Molecular Weight 156.093 g/mol
SMILES C1=C(C(=CO1)C(=O)O)C(=O)O
InChIKey SYLAFCZSYRXBJF-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Furandicarboxylic acid (CAS: 3387-26-6)?

3,4-Furandicarboxylic acid (CAS: 3387-26-6) is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 3,4-Furandicarboxylic acid (CAS: 3387-26-6)?

3,4-Furandicarboxylic acid (CAS: 3387-26-6) finds applications in various industries. It is used in ...

Compound Q&A

What precautions should be taken when handling 3,4-Furandicarboxylic acid (CAS: 3387-26-6)?

When handling 3,4-Furandicarboxylic acid (CAS: 3387-26-6), it is crucial to wear appropriate persona...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...