Compound Q&A

What are the physical and chemical properties of 3,4-Furandicarboxylic acid (CAS: 3387-26-6)?

Answer

3,4-Furandicarboxylic acid
3,4-Furandicarboxylic acid (CAS: 3387-26-6) is a crystalline solid with a molecular weight of approximately 168.11 g/mol. It has a melting point of 265-267°C and is only sparingly soluble in water. Chemically, it exhibits strong acidity and is reactive towards bases and nucleophiles. It is an important intermediate in the synthesis of various polymers and is used in the production of high-performance materials and pharmaceuticals.

About

CAS No 3387-26-6
English Name 3,4-Furandicarboxylic acid
Molecular Formula C6H4O5
Molecular Weight 156.093 g/mol
SMILES C1=C(C(=CO1)C(=O)O)C(=O)O
InChIKey SYLAFCZSYRXBJF-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 3,4-Furandicarboxylic acid (CAS: 3387-26-6) typically synthesized?

3,4-Furandicarboxylic acid is typically synthesized by the ring oxidation of 2,5-furandione. This pr...

Compound Q&A

What industries use 3,4-Furandicarboxylic acid (CAS: 3387-26-6)?

3,4-Furandicarboxylic acid (CAS: 3387-26-6) finds applications in various industries. It is used in ...

Compound Q&A

What precautions should be taken when handling 3,4-Furandicarboxylic acid (CAS: 3387-26-6)?

When handling 3,4-Furandicarboxylic acid (CAS: 3387-26-6), it is crucial to wear appropriate persona...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...