Compound Q&A

What industries use Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0)?

Answer

Ethyl 3-(trifluoromethyl)benzoate
Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0) is used primarily in the pharmaceutical industry, where it serves as a precursor for the synthesis of various organic compounds. It is also utilized in the polymer industry for its potential to improve the mechanical properties of polymers. Additionally, it finds applications in the production of sensors and as a component in certain semiconductor processes.

About

CAS No 76783-59-0
English Name Ethyl 3-(trifluoromethyl)benzoate
Molecular Formula C10H9F3O2
Molecular Weight 218.17 g/mol
SMILES CCOC(=O)C1=CC(=CC=C1)C(F)(F)F
InChIKey MHNBTKIAHHECCQ-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0)?

Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0) is a white crystalline solid with a high melting...

Compound Q&A

How is Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0) typically synthesized?

Ethyl 3-(trifluoromethyl)benzoate is typically synthesized via an esterification reaction between 3-...

Compound Q&A

What precautions should be taken when handling Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0)?

When handling Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...