Compound Q&A

What are the physical and chemical properties of Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0)?

Answer

Ethyl 3-(trifluoromethyl)benzoate
Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0) is a white crystalline solid with a high melting point. Its molecular weight is approximately 231.14 g/mol. The compound is slightly soluble in water but has good solubility in organic solvents like ethanol and acetone. It is moderately reactive towards nucleophilic substitution, making it suitable for various synthetic transformations in organic chemistry.

About

CAS No 76783-59-0
English Name Ethyl 3-(trifluoromethyl)benzoate
Molecular Formula C10H9F3O2
Molecular Weight 218.17 g/mol
SMILES CCOC(=O)C1=CC(=CC=C1)C(F)(F)F
InChIKey MHNBTKIAHHECCQ-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0) typically synthesized?

Ethyl 3-(trifluoromethyl)benzoate is typically synthesized via an esterification reaction between 3-...

Compound Q&A

What industries use Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0)?

Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0) is used primarily in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0)?

When handling Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...