Compound Q&A

How is Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0) typically synthesized?

Answer

Ethyl 3-(trifluoromethyl)benzoate
Ethyl 3-(trifluoromethyl)benzoate is typically synthesized via an esterification reaction between 3-(trifluoromethyl)benzoic acid and ethanol. The reaction is often catalyzed by an acid like sulfuric acid at elevated temperatures. The method provides good selectivity and yield, making it a common route for producing this compound in the laboratory and industry.

About

CAS No 76783-59-0
English Name Ethyl 3-(trifluoromethyl)benzoate
Molecular Formula C10H9F3O2
Molecular Weight 218.17 g/mol
SMILES CCOC(=O)C1=CC(=CC=C1)C(F)(F)F
InChIKey MHNBTKIAHHECCQ-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0)?

Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0) is a white crystalline solid with a high melting...

Compound Q&A

What industries use Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0)?

Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0) is used primarily in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0)?

When handling Ethyl 3-(trifluoromethyl)benzoate (CAS: 76783-59-0), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...